C10H23N3 — CID 63166062
1-(4-aminobutyl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 63166062) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-(4-aminobutyl)-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-(4-aminobutyl)-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 63166062 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 1-(4-aminobutyl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(CCCCN)C1 |
| InChI | InChI=1S/C10H23N3/c1-12(2)10-5-8-13(9-10)7-4-3-6-11/h10H,3-9,11H2,1-2H3 |
| InChIKey | JGFLOVMNSLXPPK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|