About 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile
3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile (PubChem CID 63166171) has the molecular formula C7H12N2O2S
and a molecular weight of 188.25 g/mol. Its IUPAC name is 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile.
Molecular Properties
| Compound Name | 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile |
| PubChem CID | 63166171 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile |
| SMILES | CN(C)C1(C#N)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12N2O2S/c1-9(2)7(5-8)3-4-12(10,11)6-7/h3-4,6H2,1-2H3 |
| InChIKey | SFZIQMYLOCCBOS-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile?
The IUPAC name of 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile (CID 63166171) is 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile.
What is the SMILES notation for 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile?
The canonical SMILES for 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile is CN(C)C1(C#N)CCS(=O)(=O)C1.
What is the InChIKey of 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile?
The InChIKey is SFZIQMYLOCCBOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2S/c1-9(2)7(5-8)3-4-12(10,11)6-7/h3-4,6H2,1-2H3.
What are the key properties of 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile?
3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile has a molecular weight of 188.25 g/mol, XLogP of -0.37, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-1,1-dioxothiolane-3-carbonitrile is sourced from PubChem (CID 63166171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).