C7H11F3N2O3S — CID 63166384
1,1-dioxo-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide (PubChem CID 63166384) has the molecular formula C7H11F3N2O3S and a molecular weight of 260.24 g/mol. Its IUPAC name is 1,1-dioxo-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 63166384 |
| Molecular Formula | C7H11F3N2O3S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1,1-dioxo-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide |
| SMILES | NC(=O)C1(NCC(F)(F)F)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H11F3N2O3S/c8-7(9,10)3-12-6(5(11)13)1-2-16(14,15)4-6/h12H,1-4H2,(H2,11,13) |
| InChIKey | LOSHXSCVBTZVFA-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |