C16H26FN3 — CID 63167614
N,N-diethyl-1-[2-(2-fluoroanilino)ethyl]pyrrolidin-3-amine (PubChem CID 63167614) has the molecular formula C16H26FN3 and a molecular weight of 279.40 g/mol. Its IUPAC name is N,N-diethyl-1-[2-(2-fluoroanilino)ethyl]pyrrolidin-3-amine.
| Compound Name | N,N-diethyl-1-[2-(2-fluoroanilino)ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 63167614 |
| Molecular Formula | C16H26FN3 |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | N,N-diethyl-1-[2-(2-fluoroanilino)ethyl]pyrrolidin-3-amine |
| SMILES | CCN(CC)C1CCN(CCNc2ccccc2F)C1 |
| InChI | InChI=1S/C16H26FN3/c1-3-20(4-2)14-9-11-19(13-14)12-10-18-16-8-6-5-7-15(16)17/h5-8,14,18H,3-4,9-13H2,1-2H3 |
| InChIKey | QWMZJGFQKNTZNR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |