C15H20FN3O2 — CID 63167995
(5-amino-2-fluorophenyl)-(3-morpholin-4-ylpyrrolidin-1-yl)methanone (PubChem CID 63167995) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is (5-amino-2-fluorophenyl)-(3-morpholin-4-ylpyrrolidin-1-yl)methanone.
| Compound Name | (5-amino-2-fluorophenyl)-(3-morpholin-4-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 63167995 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (5-amino-2-fluorophenyl)-(3-morpholin-4-ylpyrrolidin-1-yl)methanone |
| SMILES | Nc1ccc(F)c(C(=O)N2CCC(N3CCOCC3)C2)c1 |
| InChI | InChI=1S/C15H20FN3O2/c16-14-2-1-11(17)9-13(14)15(20)19-4-3-12(10-19)18-5-7-21-8-6-18/h1-2,9,12H,3-8,10,17H2 |
| InChIKey | PYYWXWKMCSYWRY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|