C16H22FN3S — CID 63169839
3-fluoro-4-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]benzenecarbothioamide (PubChem CID 63169839) has the molecular formula C16H22FN3S and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-fluoro-4-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-fluoro-4-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 63169839 |
| Molecular Formula | C16H22FN3S |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-fluoro-4-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(CN2CCC(N3CCCC3)C2)c(F)c1 |
| InChI | InChI=1S/C16H22FN3S/c17-15-9-12(16(18)21)3-4-13(15)10-19-8-5-14(11-19)20-6-1-2-7-20/h3-4,9,14H,1-2,5-8,10-11H2,(H2,18,21) |
| InChIKey | VRVUWCBEHMZZBB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|