C16H21FN2O2 — CID 63170206
5-fluoro-2-(3-piperidin-1-ylpyrrolidin-1-yl)benzoic acid (PubChem CID 63170206) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is 5-fluoro-2-(3-piperidin-1-ylpyrrolidin-1-yl)benzoic acid.
| Compound Name | 5-fluoro-2-(3-piperidin-1-ylpyrrolidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 63170206 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 5-fluoro-2-(3-piperidin-1-ylpyrrolidin-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1N1CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C16H21FN2O2/c17-12-4-5-15(14(10-12)16(20)21)19-9-6-13(11-19)18-7-2-1-3-8-18/h4-5,10,13H,1-3,6-9,11H2,(H,20,21) |
| InChIKey | XZZNRAMBQLOWAW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |