C15H28N4O — CID 63171009
4-(3-morpholin-4-ylpyrrolidin-1-yl)-2-(propan-2-ylamino)butanenitrile (PubChem CID 63171009) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 4-(3-morpholin-4-ylpyrrolidin-1-yl)-2-(propan-2-ylamino)butanenitrile.
| Compound Name | 4-(3-morpholin-4-ylpyrrolidin-1-yl)-2-(propan-2-ylamino)butanenitrile |
|---|---|
| PubChem CID | 63171009 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 4-(3-morpholin-4-ylpyrrolidin-1-yl)-2-(propan-2-ylamino)butanenitrile |
| SMILES | CC(C)NC(C#N)CCN1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C15H28N4O/c1-13(2)17-14(11-16)3-5-18-6-4-15(12-18)19-7-9-20-10-8-19/h13-15,17H,3-10,12H2,1-2H3 |
| InChIKey | POUWYEHLYXOSEA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 51.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |