About 1-(2,2-dimethylmorpholin-4-yl)ethanimine
1-(2,2-dimethylmorpholin-4-yl)ethanimine (PubChem CID 63172917) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-(2,2-dimethylmorpholin-4-yl)ethanimine.
Molecular Properties
| Compound Name | 1-(2,2-dimethylmorpholin-4-yl)ethanimine |
| PubChem CID | 63172917 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-(2,2-dimethylmorpholin-4-yl)ethanimine |
| SMILES | [H]/N=C(\C)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C8H16N2O/c1-7(9)10-4-5-11-8(2,3)6-10/h9H,4-6H2,1-3H3/b9-7+ |
| InChIKey | YWMDYUGWLNCHQE-VQHVLOKHSA-N |
| XLogP | 1.09 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethylmorpholin-4-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylmorpholin-4-yl)ethanimine?
The IUPAC name of 1-(2,2-dimethylmorpholin-4-yl)ethanimine (CID 63172917) is 1-(2,2-dimethylmorpholin-4-yl)ethanimine.
What is the SMILES notation for 1-(2,2-dimethylmorpholin-4-yl)ethanimine?
The canonical SMILES for 1-(2,2-dimethylmorpholin-4-yl)ethanimine is [H]/N=C(\C)N1CCOC(C)(C)C1.
What is the InChIKey of 1-(2,2-dimethylmorpholin-4-yl)ethanimine?
The InChIKey is YWMDYUGWLNCHQE-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7(9)10-4-5-11-8(2,3)6-10/h9H,4-6H2,1-3H3/b9-7+.
What are the key properties of 1-(2,2-dimethylmorpholin-4-yl)ethanimine?
1-(2,2-dimethylmorpholin-4-yl)ethanimine has a molecular weight of 156.23 g/mol, XLogP of 1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylmorpholin-4-yl)ethanimine is sourced from PubChem (CID 63172917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).