About N'-(3,5-dichlorophenyl)ethanimidamide
N'-(3,5-dichlorophenyl)ethanimidamide (PubChem CID 63173176) has the molecular formula C8H8Cl2N2
and a molecular weight of 203.07 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)ethanimidamide.
Molecular Properties
| Compound Name | N'-(3,5-dichlorophenyl)ethanimidamide |
| PubChem CID | 63173176 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | N'-(3,5-dichlorophenyl)ethanimidamide |
| SMILES | C/C(N)=N\c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2N2/c1-5(11)12-8-3-6(9)2-7(10)4-8/h2-4H,1H3,(H2,11,12) |
| InChIKey | QCUOYLFYUNZINW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,5-dichlorophenyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,5-dichlorophenyl)ethanimidamide?
The IUPAC name of N'-(3,5-dichlorophenyl)ethanimidamide (CID 63173176) is N'-(3,5-dichlorophenyl)ethanimidamide.
What is the SMILES notation for N'-(3,5-dichlorophenyl)ethanimidamide?
The canonical SMILES for N'-(3,5-dichlorophenyl)ethanimidamide is C/C(N)=N\c1cc(Cl)cc(Cl)c1.
What is the InChIKey of N'-(3,5-dichlorophenyl)ethanimidamide?
The InChIKey is QCUOYLFYUNZINW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N2/c1-5(11)12-8-3-6(9)2-7(10)4-8/h2-4H,1H3,(H2,11,12).
What are the key properties of N'-(3,5-dichlorophenyl)ethanimidamide?
N'-(3,5-dichlorophenyl)ethanimidamide has a molecular weight of 203.07 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,5-dichlorophenyl)ethanimidamide is sourced from PubChem (CID 63173176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).