About 2-(1-aminoethylideneamino)-N,N-dimethylacetamide
2-(1-aminoethylideneamino)-N,N-dimethylacetamide (PubChem CID 63173235) has the molecular formula C6H13N3O
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-(1-aminoethylideneamino)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(1-aminoethylideneamino)-N,N-dimethylacetamide |
|---|
| PubChem CID | 63173235 |
|---|
| Molecular Formula | C6H13N3O |
|---|
| Molecular Weight | 143.19 g/mol |
|---|
| Exact Mass | 143.11 |
|---|
| IUPAC Name | 2-(1-aminoethylideneamino)-N,N-dimethylacetamide |
|---|
| SMILES | C/C(N)=N\CC(=O)N(C)C |
|---|
| InChI | InChI=1S/C6H13N3O/c1-5(7)8-4-6(10)9(2)3/h4H2,1-3H3,(H2,7,8) |
|---|
| InChIKey | UEFOSTUYWBVFIZ-UHFFFAOYSA-N |
|---|
| XLogP | -0.55 |
|---|
| TPSA | 58.69 Ų |
|---|
| H-Bond Donors | 1 |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-aminoethylideneamino)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminoethylideneamino)-N,N-dimethylacetamide?
The IUPAC name of 2-(1-aminoethylideneamino)-N,N-dimethylacetamide (CID 63173235) is 2-(1-aminoethylideneamino)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(1-aminoethylideneamino)-N,N-dimethylacetamide?
The canonical SMILES for 2-(1-aminoethylideneamino)-N,N-dimethylacetamide is C/C(N)=N\CC(=O)N(C)C.
What is the InChIKey of 2-(1-aminoethylideneamino)-N,N-dimethylacetamide?
The InChIKey is UEFOSTUYWBVFIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O/c1-5(7)8-4-6(10)9(2)3/h4H2,1-3H3,(H2,7,8).
What are the key properties of 2-(1-aminoethylideneamino)-N,N-dimethylacetamide?
2-(1-aminoethylideneamino)-N,N-dimethylacetamide has a molecular weight of 143.19 g/mol, XLogP of -0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminoethylideneamino)-N,N-dimethylacetamide is sourced from PubChem (CID 63173235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).