About 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide
2-(1-aminoethylideneamino)-N,N-dimethylpropanamide (PubChem CID 63173364) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide |
| PubChem CID | 63173364 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide |
| SMILES | C/C(N)=N\C(C)C(=O)N(C)C |
| InChI | InChI=1S/C7H15N3O/c1-5(9-6(2)8)7(11)10(3)4/h5H,1-4H3,(H2,8,9) |
| InChIKey | BUVVVFDMKMBPKF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide?
The IUPAC name of 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide (CID 63173364) is 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide.
What is the SMILES notation for 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide?
The canonical SMILES for 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide is C/C(N)=N\C(C)C(=O)N(C)C.
What is the InChIKey of 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide?
The InChIKey is BUVVVFDMKMBPKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O/c1-5(9-6(2)8)7(11)10(3)4/h5H,1-4H3,(H2,8,9).
What are the key properties of 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide?
2-(1-aminoethylideneamino)-N,N-dimethylpropanamide has a molecular weight of 157.22 g/mol, XLogP of -0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminoethylideneamino)-N,N-dimethylpropanamide is sourced from PubChem (CID 63173364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).