C13H21BrN4O2S — CID 63175019
5-bromo-3-[3-(diethylamino)pyrrolidin-1-yl]sulfonylpyridin-2-amine (PubChem CID 63175019) has the molecular formula C13H21BrN4O2S and a molecular weight of 377.31 g/mol. Its IUPAC name is 5-bromo-3-[3-(diethylamino)pyrrolidin-1-yl]sulfonylpyridin-2-amine.
| Compound Name | 5-bromo-3-[3-(diethylamino)pyrrolidin-1-yl]sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 63175019 |
| Molecular Formula | C13H21BrN4O2S |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 5-bromo-3-[3-(diethylamino)pyrrolidin-1-yl]sulfonylpyridin-2-amine |
| SMILES | CCN(CC)C1CCN(S(=O)(=O)c2cc(Br)cnc2N)C1 |
| InChI | InChI=1S/C13H21BrN4O2S/c1-3-17(4-2)11-5-6-18(9-11)21(19,20)12-7-10(14)8-16-13(12)15/h7-8,11H,3-6,9H2,1-2H3,(H2,15,16) |
| InChIKey | JZIRNKQVEYAUQV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |