C28H32FN5O2S2 — CID 6317543
1-butyl-6-(4-ethylpiperazin-1-yl)-5-[(Z)-[3-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 6317543) has the molecular formula C28H32FN5O2S2 and a molecular weight of 553.73 g/mol. Its IUPAC name is 1-butyl-6-(4-ethylpiperazin-1-yl)-5-[(Z)-[3-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-6-(4-ethylpiperazin-1-yl)-5-[(Z)-[3-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6317543 |
| Molecular Formula | C28H32FN5O2S2 |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 1-butyl-6-(4-ethylpiperazin-1-yl)-5-[(Z)-[3-[(4-fluorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CCN(CC)CC2)c(/C=C2\SC(=S)N(Cc3ccc(F)cc3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C28H32FN5O2S2/c1-4-6-11-33-25(32-14-12-31(5-2)13-15-32)22(19(3)23(17-30)26(33)35)16-24-27(36)34(28(37)38-24)18-20-7-9-21(29)10-8-20/h7-10,16H,4-6,11-15,18H2,1-3H3/b24-16- |
| InChIKey | RTQNPVQTOROZGN-JLPGSUDCSA-N |
| XLogP | 4.51 |
| TPSA | 72.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|