About 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine
1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine (PubChem CID 63175909) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine.
Molecular Properties
| Compound Name | 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine |
| PubChem CID | 63175909 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine |
| SMILES | [H]/N=C(/N1CC(C)OCC1C)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O/c1-8-7-14-9(2)6-13(8)10(12)11(3,4)5/h8-9,12H,6-7H2,1-5H3/b12-10+ |
| InChIKey | SJQUOEHZBLPAGN-ZRDIBKRKSA-N |
| XLogP | 2.12 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine?
The IUPAC name of 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine (CID 63175909) is 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine.
What is the SMILES notation for 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine?
The canonical SMILES for 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine is [H]/N=C(/N1CC(C)OCC1C)C(C)(C)C.
What is the InChIKey of 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine?
The InChIKey is SJQUOEHZBLPAGN-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H22N2O/c1-8-7-14-9(2)6-13(8)10(12)11(3,4)5/h8-9,12H,6-7H2,1-5H3/b12-10+.
What are the key properties of 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine?
1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine has a molecular weight of 198.31 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethylmorpholin-4-yl)-2,2-dimethylpropan-1-imine is sourced from PubChem (CID 63175909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).