About cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine
cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine (PubChem CID 63175916) has the molecular formula C8H14N2O2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine.
Molecular Properties
| Compound Name | cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine |
| PubChem CID | 63175916 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine |
| SMILES | [H]/N=C(\C1CC1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H14N2O2S/c9-8(7-1-2-7)10-3-5-13(11,12)6-4-10/h7,9H,1-6H2/b9-8+ |
| InChIKey | UEPPLBQTAZLADQ-CMDGGOBGSA-N |
| XLogP | 0.10 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine?
The IUPAC name of cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine (CID 63175916) is cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine.
What is the SMILES notation for cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine?
The canonical SMILES for cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine is [H]/N=C(\C1CC1)N1CCS(=O)(=O)CC1.
What is the InChIKey of cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine?
The InChIKey is UEPPLBQTAZLADQ-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H14N2O2S/c9-8(7-1-2-7)10-3-5-13(11,12)6-4-10/h7,9H,1-6H2/b9-8+.
What are the key properties of cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine?
cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine has a molecular weight of 202.28 g/mol, XLogP of 0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanimine is sourced from PubChem (CID 63175916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).