About cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine
cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine (PubChem CID 63176106) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine.
Molecular Properties
| Compound Name | cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine |
| PubChem CID | 63176106 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine |
| SMILES | [H]/N=C(\C1CCCC1)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C12H22N2O/c1-12(2)9-14(7-8-15-12)11(13)10-5-3-4-6-10/h10,13H,3-9H2,1-2H3/b13-11+ |
| InChIKey | XHACTNSENYTZBG-ACCUITESSA-N |
| XLogP | 2.26 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine?
The IUPAC name of cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine (CID 63176106) is cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine.
What is the SMILES notation for cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine?
The canonical SMILES for cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine is [H]/N=C(\C1CCCC1)N1CCOC(C)(C)C1.
What is the InChIKey of cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine?
The InChIKey is XHACTNSENYTZBG-ACCUITESSA-N. The full InChI is InChI=1S/C12H22N2O/c1-12(2)9-14(7-8-15-12)11(13)10-5-3-4-6-10/h10,13H,3-9H2,1-2H3/b13-11+.
What are the key properties of cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine?
cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine has a molecular weight of 210.32 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-(2,2-dimethylmorpholin-4-yl)methanimine is sourced from PubChem (CID 63176106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).