About N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide
N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide (PubChem CID 63176137) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide |
| PubChem CID | 63176137 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide |
| SMILES | [H]/N=C(/N(CC)C1CC1)C(C)(C)C |
| InChI | InChI=1S/C10H20N2/c1-5-12(8-6-7-8)9(11)10(2,3)4/h8,11H,5-7H2,1-4H3/b11-9+ |
| InChIKey | PUMQJHARHJRCRI-PKNBQFBNSA-N |
| XLogP | 2.49 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide?
The IUPAC name of N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide (CID 63176137) is N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide.
What is the SMILES notation for N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide?
The canonical SMILES for N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide is [H]/N=C(/N(CC)C1CC1)C(C)(C)C.
What is the InChIKey of N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide?
The InChIKey is PUMQJHARHJRCRI-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H20N2/c1-5-12(8-6-7-8)9(11)10(2,3)4/h8,11H,5-7H2,1-4H3/b11-9+.
What are the key properties of N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide?
N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide has a molecular weight of 168.28 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-ethyl-2,2-dimethylpropanimidamide is sourced from PubChem (CID 63176137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).