C10H17N3S — CID 63176433
N,2,2-trimethyl-N-(1,3-thiazol-4-ylmethyl)propanimidamide (PubChem CID 63176433) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is N,2,2-trimethyl-N-(1,3-thiazol-4-ylmethyl)propanimidamide.
| Compound Name | N,2,2-trimethyl-N-(1,3-thiazol-4-ylmethyl)propanimidamide |
|---|---|
| PubChem CID | 63176433 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N,2,2-trimethyl-N-(1,3-thiazol-4-ylmethyl)propanimidamide |
| SMILES | [H]/N=C(\N(C)Cc1cscn1)C(C)(C)C |
| InChI | InChI=1S/C10H17N3S/c1-10(2,3)9(11)13(4)5-8-6-14-7-12-8/h6-7,11H,5H2,1-4H3/b11-9- |
| InChIKey | WFIJVQNKSACICV-LUAWRHEFSA-N |
| XLogP | 2.60 |
| TPSA | 39.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|