C13H26N2 — CID 63176537
2,2-dimethyl-1-(4-propylpiperidin-1-yl)propan-1-imine (PubChem CID 63176537) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-propylpiperidin-1-yl)propan-1-imine.
| Compound Name | 2,2-dimethyl-1-(4-propylpiperidin-1-yl)propan-1-imine |
|---|---|
| PubChem CID | 63176537 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2,2-dimethyl-1-(4-propylpiperidin-1-yl)propan-1-imine |
| SMILES | [H]/N=C(\N1CCC(CCC)CC1)C(C)(C)C |
| InChI | InChI=1S/C13H26N2/c1-5-6-11-7-9-15(10-8-11)12(14)13(2,3)4/h11,14H,5-10H2,1-4H3/b14-12- |
| InChIKey | KGHYGVUYZGOERH-OWBHPGMISA-N |
| XLogP | 3.52 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|