About 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide
2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide (PubChem CID 63177184) has the molecular formula C9H15N3S
and a molecular weight of 197.31 g/mol. Its IUPAC name is 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide.
Molecular Properties
| Compound Name | 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide |
| PubChem CID | 63177184 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide |
| SMILES | CC(C)(C)/C(N)=N/Cc1nccs1 |
| InChI | InChI=1S/C9H15N3S/c1-9(2,3)8(10)12-6-7-11-4-5-13-7/h4-5H,6H2,1-3H3,(H2,10,12) |
| InChIKey | QUNIPCHWORHTNJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide?
The IUPAC name of 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide (CID 63177184) is 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide.
What is the SMILES notation for 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide?
The canonical SMILES for 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide is CC(C)(C)/C(N)=N/Cc1nccs1.
What is the InChIKey of 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide?
The InChIKey is QUNIPCHWORHTNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S/c1-9(2,3)8(10)12-6-7-11-4-5-13-7/h4-5H,6H2,1-3H3,(H2,10,12).
What are the key properties of 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide?
2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide has a molecular weight of 197.31 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N'-(1,3-thiazol-2-ylmethyl)propanimidamide is sourced from PubChem (CID 63177184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).