C11H13FN2 — CID 63178403
N'-(2-fluoro-4-methylphenyl)cyclopropanecarboximidamide (PubChem CID 63178403) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is N'-(2-fluoro-4-methylphenyl)cyclopropanecarboximidamide.
| Compound Name | N'-(2-fluoro-4-methylphenyl)cyclopropanecarboximidamide |
|---|---|
| PubChem CID | 63178403 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | N'-(2-fluoro-4-methylphenyl)cyclopropanecarboximidamide |
| SMILES | Cc1ccc(/N=C(\N)C2CC2)c(F)c1 |
| InChI | InChI=1S/C11H13FN2/c1-7-2-5-10(9(12)6-7)14-11(13)8-3-4-8/h2,5-6,8H,3-4H2,1H3,(H2,13,14) |
| InChIKey | SKBIBBYTLFQLHJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|