About 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine
1-(azepan-1-yl)-2,2-dimethylpropan-1-imine (PubChem CID 63178893) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine.
Molecular Properties
| Compound Name | 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine |
| PubChem CID | 63178893 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine |
| SMILES | [H]/N=C(\N1CCCCCC1)C(C)(C)C |
| InChI | InChI=1S/C11H22N2/c1-11(2,3)10(12)13-8-6-4-5-7-9-13/h12H,4-9H2,1-3H3/b12-10- |
| InChIKey | MJYGCLXNSSVXMK-BENRWUELSA-N |
| XLogP | 2.89 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine?
The IUPAC name of 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine (CID 63178893) is 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine.
What is the SMILES notation for 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine?
The canonical SMILES for 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine is [H]/N=C(\N1CCCCCC1)C(C)(C)C.
What is the InChIKey of 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine?
The InChIKey is MJYGCLXNSSVXMK-BENRWUELSA-N. The full InChI is InChI=1S/C11H22N2/c1-11(2,3)10(12)13-8-6-4-5-7-9-13/h12H,4-9H2,1-3H3/b12-10-.
What are the key properties of 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine?
1-(azepan-1-yl)-2,2-dimethylpropan-1-imine has a molecular weight of 182.31 g/mol, XLogP of 2.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azepan-1-yl)-2,2-dimethylpropan-1-imine is sourced from PubChem (CID 63178893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).