About N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide
N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide (PubChem CID 63178907) has the molecular formula C12H14Cl2N2
and a molecular weight of 257.16 g/mol. Its IUPAC name is N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide.
Molecular Properties
| Compound Name | N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide |
| PubChem CID | 63178907 |
| Molecular Formula | C12H14Cl2N2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide |
| SMILES | N/C(=N\c1ccc(Cl)c(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C12H14Cl2N2/c13-10-6-5-9(7-11(10)14)16-12(15)8-3-1-2-4-8/h5-8H,1-4H2,(H2,15,16) |
| InChIKey | XEUMYVMFFMEYBZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide?
The IUPAC name of N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide (CID 63178907) is N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide.
What is the SMILES notation for N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide?
The canonical SMILES for N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide is N/C(=N\c1ccc(Cl)c(Cl)c1)C1CCCC1.
What is the InChIKey of N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide?
The InChIKey is XEUMYVMFFMEYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2N2/c13-10-6-5-9(7-11(10)14)16-12(15)8-3-1-2-4-8/h5-8H,1-4H2,(H2,15,16).
What are the key properties of N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide?
N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide has a molecular weight of 257.16 g/mol, XLogP of 4.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,4-dichlorophenyl)cyclopentanecarboximidamide is sourced from PubChem (CID 63178907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).