C15H21N3 — CID 63180601
6-N,6-N,2-triethylquinoline-4,6-diamine (PubChem CID 63180601) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 6-N,6-N,2-triethylquinoline-4,6-diamine.
| Compound Name | 6-N,6-N,2-triethylquinoline-4,6-diamine |
|---|---|
| PubChem CID | 63180601 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 6-N,6-N,2-triethylquinoline-4,6-diamine |
| SMILES | CCc1cc(N)c2cc(N(CC)CC)ccc2n1 |
| InChI | InChI=1S/C15H21N3/c1-4-11-9-14(16)13-10-12(18(5-2)6-3)7-8-15(13)17-11/h7-10H,4-6H2,1-3H3,(H2,16,17) |
| InChIKey | KZTVLGTXMRLCMQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |