C15H11FN2O3 — CID 63180886
4-(2,5-dimethyl-4-nitrophenoxy)-3-fluorobenzonitrile (PubChem CID 63180886) has the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. Its IUPAC name is 4-(2,5-dimethyl-4-nitrophenoxy)-3-fluorobenzonitrile.
| Compound Name | 4-(2,5-dimethyl-4-nitrophenoxy)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 63180886 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-(2,5-dimethyl-4-nitrophenoxy)-3-fluorobenzonitrile |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1Oc1ccc(C#N)cc1F |
| InChI | InChI=1S/C15H11FN2O3/c1-9-6-15(10(2)5-13(9)18(19)20)21-14-4-3-11(8-17)7-12(14)16/h3-7H,1-2H3 |
| InChIKey | ADDIUENTDCDGMO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|