C12H25N3 — CID 63181322
N,N-diethyl-1-(2-methylpropanimidoyl)pyrrolidin-3-amine (PubChem CID 63181322) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is N,N-diethyl-1-(2-methylpropanimidoyl)pyrrolidin-3-amine.
| Compound Name | N,N-diethyl-1-(2-methylpropanimidoyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 63181322 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | N,N-diethyl-1-(2-methylpropanimidoyl)pyrrolidin-3-amine |
| SMILES | [H]/N=C(\C(C)C)N1CCC(N(CC)CC)C1 |
| InChI | InChI=1S/C12H25N3/c1-5-14(6-2)11-7-8-15(9-11)12(13)10(3)4/h10-11,13H,5-9H2,1-4H3/b13-12+ |
| InChIKey | HWMAYIPZAAXMRJ-OUKQBFOZSA-N |
| XLogP | 2.04 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|