About cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine
cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine (PubChem CID 63181565) has the molecular formula C10H16F3N3
and a molecular weight of 235.25 g/mol. Its IUPAC name is cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine.
Molecular Properties
| Compound Name | cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine |
| PubChem CID | 63181565 |
| Molecular Formula | C10H16F3N3 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine |
| SMILES | [H]/N=C(\C1CC1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16F3N3/c11-10(12,13)7-15-3-5-16(6-4-15)9(14)8-1-2-8/h8,14H,1-7H2/b14-9+ |
| InChIKey | UXSUNVIBXOYZJA-NTEUORMPSA-N |
| XLogP | 1.55 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine?
The IUPAC name of cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine (CID 63181565) is cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine.
What is the SMILES notation for cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine?
The canonical SMILES for cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine is [H]/N=C(\C1CC1)N1CCN(CC(F)(F)F)CC1.
What is the InChIKey of cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine?
The InChIKey is UXSUNVIBXOYZJA-NTEUORMPSA-N. The full InChI is InChI=1S/C10H16F3N3/c11-10(12,13)7-15-3-5-16(6-4-15)9(14)8-1-2-8/h8,14H,1-7H2/b14-9+.
What are the key properties of cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine?
cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine has a molecular weight of 235.25 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanimine is sourced from PubChem (CID 63181565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).