C17H32N2O3Si2 — CID 631820
5-(2-methylpropyl)-5-prop-2-enyl-1,3-bis(trimethylsilyl)-1,3-diazinane-2,4,6-trione (PubChem CID 631820) has the molecular formula C17H32N2O3Si2 and a molecular weight of 368.63 g/mol. Its IUPAC name is 5-(2-methylpropyl)-5-prop-2-enyl-1,3-bis(trimethylsilyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-methylpropyl)-5-prop-2-enyl-1,3-bis(trimethylsilyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 631820 |
| Molecular Formula | C17H32N2O3Si2 |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 5-(2-methylpropyl)-5-prop-2-enyl-1,3-bis(trimethylsilyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(CC(C)C)C(=O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O |
| InChI | InChI=1S/C17H32N2O3Si2/c1-10-11-17(12-13(2)3)14(20)18(23(4,5)6)16(22)19(15(17)21)24(7,8)9/h10,13H,1,11-12H2,2-9H3 |
| InChIKey | FCSOKCNDOOWRJV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|