C10H13FN2 — CID 63182016
2-(4-fluorophenyl)-N,N-dimethylethanimidamide (PubChem CID 63182016) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N,N-dimethylethanimidamide.
| Compound Name | 2-(4-fluorophenyl)-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 63182016 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N,N-dimethylethanimidamide |
| SMILES | [H]/N=C(/Cc1ccc(F)cc1)N(C)C |
| InChI | InChI=1S/C10H13FN2/c1-13(2)10(12)7-8-3-5-9(11)6-4-8/h3-6,12H,7H2,1-2H3/b12-10- |
| InChIKey | AQCGJVRTTZNYJC-BENRWUELSA-N |
| XLogP | 1.91 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|