C17H21NO2 — CID 63182317
2-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]-2-phenylethanol (PubChem CID 63182317) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]-2-phenylethanol.
| Compound Name | 2-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]-2-phenylethanol |
|---|---|
| PubChem CID | 63182317 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]-2-phenylethanol |
| SMILES | CC1CC1c1ccc(CNC(CO)c2ccccc2)o1 |
| InChI | InChI=1S/C17H21NO2/c1-12-9-15(12)17-8-7-14(20-17)10-18-16(11-19)13-5-3-2-4-6-13/h2-8,12,15-16,18-19H,9-11H2,1H3 |
| InChIKey | FYLJPRUQZBXHTC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |