C18H27NO — CID 63183778
6-tert-butyl-3-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine (PubChem CID 63183778) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 6-tert-butyl-3-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine.
| Compound Name | 6-tert-butyl-3-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 63183778 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 6-tert-butyl-3-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
| SMILES | CC(C)(C)C1CCC2OCC(c3ccccc3)NC2C1 |
| InChI | InChI=1S/C18H27NO/c1-18(2,3)14-9-10-17-15(11-14)19-16(12-20-17)13-7-5-4-6-8-13/h4-8,14-17,19H,9-12H2,1-3H3 |
| InChIKey | NRZWGTJGUSOSPT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |