C15H18N2O2 — CID 63184213
N-(cyanomethyl)-N-propyl-3,4-dihydro-2H-chromene-4-carboxamide (PubChem CID 63184213) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-(cyanomethyl)-N-propyl-3,4-dihydro-2H-chromene-4-carboxamide.
| Compound Name | N-(cyanomethyl)-N-propyl-3,4-dihydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 63184213 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-(cyanomethyl)-N-propyl-3,4-dihydro-2H-chromene-4-carboxamide |
| SMILES | CCCN(CC#N)C(=O)C1CCOc2ccccc21 |
| InChI | InChI=1S/C15H18N2O2/c1-2-9-17(10-8-16)15(18)13-7-11-19-14-6-4-3-5-12(13)14/h3-6,13H,2,7,9-11H2,1H3 |
| InChIKey | KFCIAWPZNCWNHF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|