C11H14F3N3O — CID 63184597
N-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 63184597) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63184597 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | FC(F)(F)COCCNc1ncnc2c1CCC2 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)6-18-5-4-15-10-8-2-1-3-9(8)16-7-17-10/h7H,1-6H2,(H,15,16,17) |
| InChIKey | HPVSUWSMGFFMCJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|