C15H21F2N3O — CID 63185116
4-amino-3,5-difluoro-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]benzamide (PubChem CID 63185116) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-amino-3,5-difluoro-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]benzamide.
| Compound Name | 4-amino-3,5-difluoro-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 63185116 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-amino-3,5-difluoro-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]benzamide |
| SMILES | CC(C)N1CCC(CNC(=O)c2cc(F)c(N)c(F)c2)C1 |
| InChI | InChI=1S/C15H21F2N3O/c1-9(2)20-4-3-10(8-20)7-19-15(21)11-5-12(16)14(18)13(17)6-11/h5-6,9-10H,3-4,7-8,18H2,1-2H3,(H,19,21) |
| InChIKey | JGYZJFCZRKIKPR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|