1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid

C13H8F3NO3 — CID 63187503

IUPAC1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid
SMILESCn1cc(C(=O)c2cc(F)c(F)c(F)c2)cc1C(=O)O
InChIInChI=1S/C13H8F3NO3/c1-17-5-7(4-10(17)13(19)20)12(18)6-2-8(14)11(16)9(15)3-6/h2-5H,1H3,(H,19,20)
InChIKeyCYZNWGPEKKAGBQ-UHFFFAOYSA-N
MW283.21 g/mol
LogP2.37
Rot. Bonds3

About 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid

1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid (PubChem CID 63187503) has the molecular formula C13H8F3NO3 and a molecular weight of 283.21 g/mol. Its IUPAC name is 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid.

Molecular Properties

Compound Name1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid
PubChem CID63187503
Molecular FormulaC13H8F3NO3
Molecular Weight283.21 g/mol
Exact Mass283.05
IUPAC Name1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid
SMILESCn1cc(C(=O)c2cc(F)c(F)c(F)c2)cc1C(=O)O
InChIInChI=1S/C13H8F3NO3/c1-17-5-7(4-10(17)13(19)20)12(18)6-2-8(14)11(16)9(15)3-6/h2-5H,1H3,(H,19,20)
InChIKeyCYZNWGPEKKAGBQ-UHFFFAOYSA-N
XLogP2.37
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.21
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid?
The IUPAC name of 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid (CID 63187503) is 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid.
What is the SMILES notation for 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid?
The canonical SMILES for 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid is Cn1cc(C(=O)c2cc(F)c(F)c(F)c2)cc1C(=O)O.
What is the InChIKey of 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid?
The InChIKey is CYZNWGPEKKAGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F3NO3/c1-17-5-7(4-10(17)13(19)20)12(18)6-2-8(14)11(16)9(15)3-6/h2-5H,1H3,(H,19,20).
What are the key properties of 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid?
1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid has a molecular weight of 283.21 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(3,4,5-trifluorobenzoyl)pyrrole-2-carboxylic acid is sourced from PubChem (CID 63187503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).