About 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine
4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine (PubChem CID 63189288) has the molecular formula C14H15N3O
and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine.
Molecular Properties
| Compound Name | 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine |
| PubChem CID | 63189288 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine |
| SMILES | Nc1cnccc1N1CCOc2ccccc2C1 |
| InChI | InChI=1S/C14H15N3O/c15-12-9-16-6-5-13(12)17-7-8-18-14-4-2-1-3-11(14)10-17/h1-6,9H,7-8,10,15H2 |
| InChIKey | SAMQINNCRYGTMP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine?
The IUPAC name of 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine (CID 63189288) is 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine.
What is the SMILES notation for 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine?
The canonical SMILES for 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine is Nc1cnccc1N1CCOc2ccccc2C1.
What is the InChIKey of 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine?
The InChIKey is SAMQINNCRYGTMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O/c15-12-9-16-6-5-13(12)17-7-8-18-14-4-2-1-3-11(14)10-17/h1-6,9H,7-8,10,15H2.
What are the key properties of 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine?
4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine has a molecular weight of 241.29 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyridin-3-amine is sourced from PubChem (CID 63189288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).