About 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid
3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid (PubChem CID 63190046) has the molecular formula C11H9FN2O4S
and a molecular weight of 284.27 g/mol. Its IUPAC name is 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid |
| PubChem CID | 63190046 |
| Molecular Formula | C11H9FN2O4S |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid |
| SMILES | O=C1NC(C(=O)Nc2ccc(C(=O)O)cc2F)CS1 |
| InChI | InChI=1S/C11H9FN2O4S/c12-6-3-5(10(16)17)1-2-7(6)13-9(15)8-4-19-11(18)14-8/h1-3,8H,4H2,(H,13,15)(H,14,18)(H,16,17) |
| InChIKey | WUHIVCMQUXIBHC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid?
The IUPAC name of 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid (CID 63190046) is 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid.
What is the SMILES notation for 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid?
The canonical SMILES for 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid is O=C1NC(C(=O)Nc2ccc(C(=O)O)cc2F)CS1.
What is the InChIKey of 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid?
The InChIKey is WUHIVCMQUXIBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2O4S/c12-6-3-5(10(16)17)1-2-7(6)13-9(15)8-4-19-11(18)14-8/h1-3,8H,4H2,(H,13,15)(H,14,18)(H,16,17).
What are the key properties of 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid?
3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid has a molecular weight of 284.27 g/mol, XLogP of 1.29, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]benzoic acid is sourced from PubChem (CID 63190046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).