C12H15FN2O3 — CID 63190192
3-fluoro-4-(2-methylpropylcarbamoylamino)benzoic acid (PubChem CID 63190192) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is 3-fluoro-4-(2-methylpropylcarbamoylamino)benzoic acid.
| Compound Name | 3-fluoro-4-(2-methylpropylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 63190192 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-fluoro-4-(2-methylpropylcarbamoylamino)benzoic acid |
| SMILES | CC(C)CNC(=O)Nc1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C12H15FN2O3/c1-7(2)6-14-12(18)15-10-4-3-8(11(16)17)5-9(10)13/h3-5,7H,6H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | PYFVNXUHGSPYPO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |