C12H8F3NO4 — CID 63190215
5-ethoxy-2-(3,4,5-trifluorophenyl)-1,3-oxazole-4-carboxylic acid (PubChem CID 63190215) has the molecular formula C12H8F3NO4 and a molecular weight of 287.19 g/mol. Its IUPAC name is 5-ethoxy-2-(3,4,5-trifluorophenyl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-ethoxy-2-(3,4,5-trifluorophenyl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 63190215 |
| Molecular Formula | C12H8F3NO4 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 5-ethoxy-2-(3,4,5-trifluorophenyl)-1,3-oxazole-4-carboxylic acid |
| SMILES | CCOc1oc(-c2cc(F)c(F)c(F)c2)nc1C(=O)O |
| InChI | InChI=1S/C12H8F3NO4/c1-2-19-12-9(11(17)18)16-10(20-12)5-3-6(13)8(15)7(14)4-5/h3-4H,2H2,1H3,(H,17,18) |
| InChIKey | BJJOLFQXZMGOHJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|