About 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid
3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid (PubChem CID 63191432) has the molecular formula C11H13N3O6S
and a molecular weight of 315.31 g/mol. Its IUPAC name is 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid |
| PubChem CID | 63191432 |
| Molecular Formula | C11H13N3O6S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid |
| SMILES | Cc1onc2c(=O)n(CCCS(C)(=O)=O)nc(C(=O)O)c12 |
| InChI | InChI=1S/C11H13N3O6S/c1-6-7-8(13-20-6)10(15)14(12-9(7)11(16)17)4-3-5-21(2,18)19/h3-5H2,1-2H3,(H,16,17) |
| InChIKey | RQHCRSCGTJSUNA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid?
The IUPAC name of 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid (CID 63191432) is 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid.
What is the SMILES notation for 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid?
The canonical SMILES for 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid is Cc1onc2c(=O)n(CCCS(C)(=O)=O)nc(C(=O)O)c12.
What is the InChIKey of 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid?
The InChIKey is RQHCRSCGTJSUNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O6S/c1-6-7-8(13-20-6)10(15)14(12-9(7)11(16)17)4-3-5-21(2,18)19/h3-5H2,1-2H3,(H,16,17).
What are the key properties of 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid?
3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid has a molecular weight of 315.31 g/mol, XLogP of -0.17, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-(3-methylsulfonylpropyl)-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid is sourced from PubChem (CID 63191432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).