C14H22FNO2S — CID 63192315
N-ethyl-1-(3-fluorophenyl)-5-methylsulfonylpentan-2-amine (PubChem CID 63192315) has the molecular formula C14H22FNO2S and a molecular weight of 287.40 g/mol. Its IUPAC name is N-ethyl-1-(3-fluorophenyl)-5-methylsulfonylpentan-2-amine.
| Compound Name | N-ethyl-1-(3-fluorophenyl)-5-methylsulfonylpentan-2-amine |
|---|---|
| PubChem CID | 63192315 |
| Molecular Formula | C14H22FNO2S |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-ethyl-1-(3-fluorophenyl)-5-methylsulfonylpentan-2-amine |
| SMILES | CCNC(CCCS(C)(=O)=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H22FNO2S/c1-3-16-14(8-5-9-19(2,17)18)11-12-6-4-7-13(15)10-12/h4,6-7,10,14,16H,3,5,8-9,11H2,1-2H3 |
| InChIKey | LVHJEYOGIMEQAX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |