C17H23NO2S — CID 63192640
N-ethyl-4-methylsulfonyl-1-naphthalen-2-ylbutan-1-amine (PubChem CID 63192640) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is N-ethyl-4-methylsulfonyl-1-naphthalen-2-ylbutan-1-amine.
| Compound Name | N-ethyl-4-methylsulfonyl-1-naphthalen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 63192640 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-ethyl-4-methylsulfonyl-1-naphthalen-2-ylbutan-1-amine |
| SMILES | CCNC(CCCS(C)(=O)=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H23NO2S/c1-3-18-17(9-6-12-21(2,19)20)16-11-10-14-7-4-5-8-15(14)13-16/h4-5,7-8,10-11,13,17-18H,3,6,9,12H2,1-2H3 |
| InChIKey | JEAFFQMMMPNEKX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |