C19H23NO — CID 63193414
3-(N,4-dimethylanilino)-2,2-dimethyl-1-phenylpropan-1-one (PubChem CID 63193414) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-(N,4-dimethylanilino)-2,2-dimethyl-1-phenylpropan-1-one.
| Compound Name | 3-(N,4-dimethylanilino)-2,2-dimethyl-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 63193414 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 3-(N,4-dimethylanilino)-2,2-dimethyl-1-phenylpropan-1-one |
| SMILES | Cc1ccc(N(C)CC(C)(C)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO/c1-15-10-12-17(13-11-15)20(4)14-19(2,3)18(21)16-8-6-5-7-9-16/h5-13H,14H2,1-4H3 |
| InChIKey | ZZQXTGZTBNCJLT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|