C33H24N4O5S — CID 6319468
(4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6319468) has the molecular formula C33H24N4O5S and a molecular weight of 588.65 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6319468 |
| Molecular Formula | C33H24N4O5S |
| Molecular Weight | 588.65 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | (4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4c(C)nc5ccccn45)C3c3cccc(Oc4ccccc4)c3)sc2c1 |
| InChI | InChI=1S/C33H24N4O5S/c1-19-28(36-16-7-6-13-26(36)34-19)30(38)27-29(20-9-8-12-23(17-20)42-21-10-4-3-5-11-21)37(32(40)31(27)39)33-35-24-15-14-22(41-2)18-25(24)43-33/h3-18,29,38H,1-2H3/b30-27+ |
| InChIKey | WIZNEIPIBMHBEM-KDJFERLWSA-N |
| XLogP | 6.68 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.65 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|