C14H13ClN2O3S — CID 63195346
3-chloro-4-methyl-N-(3-sulfamoylphenyl)benzamide (PubChem CID 63195346) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-(3-sulfamoylphenyl)benzamide.
| Compound Name | 3-chloro-4-methyl-N-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 63195346 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 3-chloro-4-methyl-N-(3-sulfamoylphenyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(S(N)(=O)=O)c2)cc1Cl |
| InChI | InChI=1S/C14H13ClN2O3S/c1-9-5-6-10(7-13(9)15)14(18)17-11-3-2-4-12(8-11)21(16,19)20/h2-8H,1H3,(H,17,18)(H2,16,19,20) |
| InChIKey | SFFNDQCHOXNEQS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |