About 5-chloro-6,6-dimethyl-1-methylsulfonylheptane
5-chloro-6,6-dimethyl-1-methylsulfonylheptane (PubChem CID 63195588) has the molecular formula C10H21ClO2S
and a molecular weight of 240.80 g/mol. Its IUPAC name is 5-chloro-6,6-dimethyl-1-methylsulfonylheptane.
Molecular Properties
| Compound Name | 5-chloro-6,6-dimethyl-1-methylsulfonylheptane |
| PubChem CID | 63195588 |
| Molecular Formula | C10H21ClO2S |
| Molecular Weight | 240.80 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 5-chloro-6,6-dimethyl-1-methylsulfonylheptane |
| SMILES | CC(C)(C)C(Cl)CCCCS(C)(=O)=O |
| InChI | InChI=1S/C10H21ClO2S/c1-10(2,3)9(11)7-5-6-8-14(4,12)13/h9H,5-8H2,1-4H3 |
| InChIKey | KJQZWLXJKUUQFG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-6,6-dimethyl-1-methylsulfonylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6,6-dimethyl-1-methylsulfonylheptane?
The IUPAC name of 5-chloro-6,6-dimethyl-1-methylsulfonylheptane (CID 63195588) is 5-chloro-6,6-dimethyl-1-methylsulfonylheptane.
What is the SMILES notation for 5-chloro-6,6-dimethyl-1-methylsulfonylheptane?
The canonical SMILES for 5-chloro-6,6-dimethyl-1-methylsulfonylheptane is CC(C)(C)C(Cl)CCCCS(C)(=O)=O.
What is the InChIKey of 5-chloro-6,6-dimethyl-1-methylsulfonylheptane?
The InChIKey is KJQZWLXJKUUQFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21ClO2S/c1-10(2,3)9(11)7-5-6-8-14(4,12)13/h9H,5-8H2,1-4H3.
What are the key properties of 5-chloro-6,6-dimethyl-1-methylsulfonylheptane?
5-chloro-6,6-dimethyl-1-methylsulfonylheptane has a molecular weight of 240.80 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6,6-dimethyl-1-methylsulfonylheptane is sourced from PubChem (CID 63195588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).