About 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one
3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one (PubChem CID 63196611) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one.
Molecular Properties
| Compound Name | 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one |
| PubChem CID | 63196611 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one |
| SMILES | CC(=O)C(C)c1ncnc2ccsc12 |
| InChI | InChI=1S/C10H10N2OS/c1-6(7(2)13)9-10-8(3-4-14-10)11-5-12-9/h3-6H,1-2H3 |
| InChIKey | DVEVKNIJKLRLKP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one?
The IUPAC name of 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one (CID 63196611) is 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one.
What is the SMILES notation for 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one?
The canonical SMILES for 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one is CC(=O)C(C)c1ncnc2ccsc12.
What is the InChIKey of 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one?
The InChIKey is DVEVKNIJKLRLKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS/c1-6(7(2)13)9-10-8(3-4-14-10)11-5-12-9/h3-6H,1-2H3.
What are the key properties of 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one?
3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one has a molecular weight of 206.27 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thieno[3,2-d]pyrimidin-4-ylbutan-2-one is sourced from PubChem (CID 63196611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).