C23H22N4O6 — CID 6319791
(4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-methoxypropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 6319791) has the molecular formula C23H22N4O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-methoxypropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-methoxypropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6319791 |
| Molecular Formula | C23H22N4O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (4E)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-methoxypropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | COCCCN1C(=O)C(=O)/C(=C(/O)c2c(C)nc3ccccn23)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22N4O6/c1-14-19(25-10-4-3-9-17(25)24-14)21(28)18-20(15-7-5-8-16(13-15)27(31)32)26(11-6-12-33-2)23(30)22(18)29/h3-5,7-10,13,20,28H,6,11-12H2,1-2H3/b21-18+ |
| InChIKey | ZDBLMGPDHCZQJI-DYTRJAOYSA-N |
| XLogP | 3.01 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|