C16H21N3O2 — CID 63198005
N,3,3-trimethyl-1-(5-nitroquinolin-8-yl)butan-2-amine (PubChem CID 63198005) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N,3,3-trimethyl-1-(5-nitroquinolin-8-yl)butan-2-amine.
| Compound Name | N,3,3-trimethyl-1-(5-nitroquinolin-8-yl)butan-2-amine |
|---|---|
| PubChem CID | 63198005 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N,3,3-trimethyl-1-(5-nitroquinolin-8-yl)butan-2-amine |
| SMILES | CNC(Cc1ccc([N+](=O)[O-])c2cccnc12)C(C)(C)C |
| InChI | InChI=1S/C16H21N3O2/c1-16(2,3)14(17-4)10-11-7-8-13(19(20)21)12-6-5-9-18-15(11)12/h5-9,14,17H,10H2,1-4H3 |
| InChIKey | XLKHUUMCTXURTL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|